public function __construct($channel = self::CHANNEL_APPLICATION) { parent::__construct($channel); $this->addDatabaseHandler(); $le = new Event($this); Events::dispatch('on_logger_create', $le); }
public function __construct($name = 'PHPUnit', $level = 'debug') { /** * Filter growl notifications and send only * - test failures ($handerLevel = Logger::NOTICE; see GrowlHandler constructor) * - summary of test suites (message "Results OK ...", or "Results KO ..." */ $filters = array(function ($record, $handlerLevel) { if ($record['level'] > $handlerLevel) { return true; } return preg_match('/^Results/', $record['message']) === 1; }); $stream = new RotatingFileHandler(__DIR__ . DIRECTORY_SEPARATOR . 'monologTestListener.log', 0, Logger::toMonologLevel($level)); $stream->setFilenameFormat('{filename}-{date}', 'Ymd'); $handlers = array($stream); try { // be notified only for test suites and test failures $growl = new GrowlHandler(array(), Logger::NOTICE); $handlers[] = new CallbackFilterHandler($growl, $filters); } catch (\Exception $e) { // Growl server is probably not started echo $e->getMessage(), PHP_EOL, PHP_EOL; } parent::__construct($name, $handlers); }
public function __construct() { $logConfig = ApiConfig::getLogConfig(); parent::__construct($logConfig['name']); parent::pushHandler(new RotatingFileHandler("{$logConfig['log_path']}/info-log"), Logger::INFO); parent::pushHandler(new RotatingFileHandler("{$logConfig['log_path']}/info-log"), Logger::ERROR); }
public function __construct($appname = "Tranquillity", $logprio = LOG_USER, $level = \Monolog\Logger::INFO) { parent::__construct($appname); $this->loghandler = new SyslogHandler($appname, $logprio, $level); $this->pushHandler($this->loghandler); $this->logformatter = new LineFormatter("[%level_name%] %message%"); $this->loghandler->setFormatter($this->logformatter); }
public function __construct($channel = self::CHANNEL_APPLICATION, $logLevel = MonologLogger::DEBUG) { parent::__construct($channel); $this->addDatabaseHandler($logLevel); $this->pushProcessor(new PsrLogMessageProcessor()); $le = new Event($this); Events::dispatch('on_logger_create', $le); }
/** * @param string $name The logging channel * @param MonologHandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. * @param callable[] $processors Optional array of processors */ public function __construct($name, array $handlers = [], array $processors = []) { /** * This is a fix for Pthreads, since that extension does not copy static variables accross threads */ static::$levels = [self::DEBUG => 'DEBUG', self::INFO => 'INFO', self::NOTICE => 'NOTICE', self::WARNING => 'WARNING', self::ERROR => 'ERROR', self::CRITICAL => 'CRITICAL', self::ALERT => 'ALERT', self::EMERGENCY => 'EMERGENCY']; parent::__construct($name, $handlers, $processors); }
/** * @param string $name * @param array $handlers * @param array $processors */ function __construct($name = 'main', array $handlers = array(), array $processors = array()) { /* Create new logger */ parent::__construct($name, $handlers, $processors); /* Add default, console handler */ $handler = new \Monolog\Handler\StreamHandler('php://stderr', \Monolog\Logger::DEBUG); $handler->setFormatter(new \Monolog\Formatter\LineFormatter("[%datetime%] [%channel%.%level_name%] -- %message%\n")); $this->pushHandler($handler); }
public function __construct($name) { parent::__construct($name); $this->log = new StringBufferHandler(Logger::DEBUG); $this->log->setFormatter(new TaskLogFormatter()); $this->pushHandler($this->log); $this->executionTime = new ExecutionTimeProcessor(); $this->pushProcessor($this->executionTime); }
/** * Builds Monolog\Logger data with set of handlers given in configuration file. * @param string $channelName Name of logging channel * @param Settings $settings object with json-formatted config * @throws InvalidArgumentException if $channelName is not a string * @todo check handler parameters compatibility */ function __construct($channelName, Settings $settings) { if (!is_string($channelName)) { throw new \InvalidArgumentException('Channel name should be a string'); } parent::__construct($channelName); $this->settings = $settings; $this->attachHandlers(); }
public function __construct(Application $application, array $handlers = [], array $processors = [], Console $consoleHandler = null) { if ($application->isDebugMode()) { if (null === $consoleHandler) { $consoleHandler = new Console($application); } $handlers[] = $consoleHandler; } parent::__construct($application->getName(), $handlers, $processors); $this->setApplication($application)->setConsoleHandler($consoleHandler); }
public function __construct() { parent::__construct("maestro"); $conf = Manager::getConf('maestro.logs'); $this->baseDir = $conf['path']; $this->level = $conf['level']; $this->handler = $conf['handler']; $this->port = $conf['port']; $this->peer = $conf['peer']; $this->strict = $conf['strict']; if (empty($this->host)) { $this->host = $_SERVER['REMOTE_ADDR']; } }
public function __construct($configSection) { self::factoryConstruct($configSection); $config = $this->getPackageConfig(); parent::__construct($config['name']); $directory = dirname($config['path']); if (!file_exists($directory)) { $status = @mkdir($directory, 0777, true); if ($status === false) { $config['path'] = sys_get_temp_dir() . '/mpcmf.' . posix_getpid() . '.log'; $this->addCritical("Log directory creation failed, use new path instead of original. New path: {$config['path']}"); } } elseif (is_writable($directory)) { @chmod($directory, 0777); } $this->pushHandler(new StreamHandler($config['path'], $config['level'])); MPCMF_DEBUG && $this->addDebug("New log created: {$this->configSection}"); }
public function __construct($name = '', $debug = false) { $options = getopt("", ['debug']); if (isset($options['debug'])) { // Default format with all the info for dev debug $formatter = new LineFormatter(); $debug = true; } elseif (!empty($debug)) { // Set user debug mode $formatter = new LineFormatter("%level_name%: %message% %context% %extra%\n"); } else { // Simple message (TODO add user readable $context) $formatter = new LineFormatter("%message%\n"); } $errHandler = new StreamHandler('php://stderr', \Monolog\Logger::NOTICE, false); $level = $debug ? \Monolog\Logger::DEBUG : \Monolog\Logger::INFO; $handler = new StreamHandler('php://stdout', $level); $handler->setFormatter($formatter); parent::__construct($name, [$errHandler, $handler]); }
/** * @param string $name The logging channel * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. * @param callable[] $processors Optional array of processors */ public function __construct($name, array $handlers = array(), array $processors = array()) { parent::__construct($name, $handlers, $processors); // set handler $elgg_log_level = _elgg_services()->logger->getLevel(); if ($elgg_log_level == \Elgg\Logger::OFF) { // always log errors $elgg_log_level = \Elgg\Logger::ERROR; } $handler = new RotatingFileHandler(elgg_get_data_path() . 'elasticsearch/client.log', 0, $elgg_log_level); // create correct folder structure $date = date('Y/m/'); $path = elgg_get_data_path() . "elasticsearch/{$date}"; if (!is_dir($path)) { mkdir($path, 0755, true); } $handler->setFilenameFormat('{date}_{filename}', 'Y/m/d'); $this->pushHandler($handler); // set logging processor $processor = new IntrospectionProcessor(); $this->pushProcessor($processor); }
/** * Console logger class constructor * * @param string $name The logging channel * @param string $level The minimum logging level */ public function __construct($name = 'YourLogger', $level = Logger::DEBUG) { $filterRules = array(function ($record) { if (!array_key_exists('operation', $record['context'])) { return false; } return 'printFooter' === $record['context']['operation']; }); $stream = new RotatingFileHandler(__DIR__ . '/phpunit-growlhandler-php' . PHP_VERSION_ID . '.log', 30); $stream->setFilenameFormat('{filename}-{date}', 'Ymd'); $console = new StreamHandler('php://stdout'); $console->setFormatter(new LineFormatter("%message%\n", null, true)); $filter = new FilterHandler($console); $handlers = array($filter, $stream); try { $options = array('resourceDir' => dirname(__DIR__) . '/vendor/pear-pear.php.net/Net_Growl/data/Net_Growl/data', 'defaultIcon' => '80/growl_phpunit.png'); $growl = new GrowlHandler(array('name' => 'PHPUnit ResultPrinter', 'options' => $options), Logger::NOTICE); $growl->setFormatter(new LineFormatter("Growl for Monolog\n" . "%message%")); $handlers[] = new CallbackFilterHandler($growl, $filterRules); } catch (\Exception $e) { // Growl server is probably not started } parent::__construct($name, $handlers); }
public function __construct($name, $logDirectory) { $this->logPath = $logDirectory . '/' . $name; parent::__construct($name); $this->configureLogger(); }
public function __construct($logDir) { parent::__construct('note-script'); $this->pushHandler(new SyslogHandler($this->getName(), 'user', Monolog::ERROR)); $this->pushHandler(new RotatingFileHandler($logDir . '/note-script.log', 10, Monolog::DEBUG)); }
public function __construct($name) { parent::__construct($name); $this->selfCounter = 0; }
public function __construct($name, Logger $parentLogger) { parent::__construct($name, [], []); $this->parentLogger = $parentLogger; }
/** * * Ctor * @param string $name * @param string $file * @param integer $level */ public function __construct($name, $file, $level) { parent::__construct($name); $this->pushHandler($this->getHandler($file, $level)); }
/** * @param string $name * @param array $handlers * @param array $processors */ public function __construct($name = 'Migration', array $handlers = [], array $processors = []) { parent::__construct($name, $handlers, $processors); }
public function __construct($name) { $mongo = new \MongoClient(Config::$get->database->mongodb); parent::__construct($name, [new StreamHandler(Config::$get->logging->file), new MongoDBHandler($mongo, Config::$get->logging->mongodb->database, Config::$get->logging->mongodb->collection)]); }
/** * @param LogFactory $logFactory * @param \ShipperHQ\Common\Helper\Data $dataHelper * @param string $name The logging channel * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. * @param callable[] $processors Optional array of processors */ public function __construct(LogFactory $logFactory, \ShipperHQ\Common\Helper\Data $dataHelper, $name, array $handlers = array(), array $processors = array()) { $this->logFactory = $logFactory; $this->helper = $dataHelper; parent::__construct($name, $handlers, $processors); }
public function __construct($name = 'testlogger', array $handlers = array(), array $processors = array()) { parent::__construct($name, $handlers, $processors); $this->testHandler = new SolrReindexTest_Handler(); $this->pushHandler($this->testHandler); }
public function __construct($name = 'CloudFoundry Helper', array $processors = array()) { parent::__construct($name, array(), $processors); }
/** * @param Debugger $debugger */ public function __construct(Debugger $debugger) { parent::__construct(static::class, $debugger->logHandlers(static::class)); }
public function __construct() { parent::__construct(APP_NAME_SHORT); $path = '../logs/' . APP_NAME_SHORT . 'log.log'; $this->pushHandler(new \Monolog\Handler\StreamHandler($path, Logger::DEBUG)); }
/** * @param string $name The logging channel * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. * @param callable[] $processors Optional array of processors */ public function __construct(string $name = 'debug', array $handlers = array(), array $processors = array()) { parent::__construct($name, $handlers, $processors); }
/** * @param string $name * @param HandlerInterface[] $handlers * @param ProcessorInterface[] $processors */ public function __construct($name, array $handlers, array $processors) { parent::__construct($name, $handlers, $processors); }
public function __construct($name, Logger $parentLogger) { parent::__construct($name, array(), array()); $this->parentLogger = $parentLogger; }