/**
* Записывает сообщение в лог.
* @param string $level уровень критичности сообщения
* @param string $message сообщение, поддерживает плейсхолдеры в формате {placeholder}
* @param array $placeholders список плейсхолдеров
* @return self
*/
protected function log($level, $message, array $placeholders = [])
{
if ($this->traitLogger) {
$this->traitLogger->log($level, $message, $placeholders);
}
return $this;
}
/**
* Appends the given message along with the additional information into the log.
*
* @param string $message The message to log
* @param integer $severity One of the LOG_* constants
* @param mixed $additionalData A variable containing more information about the event to be logged
* @param string $packageKey Key of the package triggering the log (determined automatically if not specified)
* @param string $className Name of the class triggering the log (determined automatically if not specified)
* @param string $methodName Name of the method triggering the log (determined automatically if not specified)
* @return void
* @api
*/
public function append($message, $severity = LOG_INFO, $additionalData = NULL, $packageKey = NULL, $className = NULL, $methodName = NULL)
{
switch ($severity) {
case LOG_EMERG:
$monologLevel = Logger::EMERGENCY;
break;
case LOG_ALERT:
$monologLevel = Logger::ALERT;
break;
case LOG_CRIT:
$monologLevel = Logger::CRITICAL;
break;
case LOG_ERR:
$monologLevel = Logger::ERROR;
break;
case LOG_WARNING:
$monologLevel = Logger::WARNING;
break;
case LOG_NOTICE:
$monologLevel = Logger::NOTICE;
break;
case LOG_DEBUG:
$monologLevel = Logger::DEBUG;
break;
default:
$monologLevel = Logger::INFO;
break;
}
$this->logger->log($monologLevel, $message, ['packageKey' => $packageKey, 'className' => $className, 'methodName' => $methodName, 'additionalData' => $additionalData]);
}
/**
* The three arguments below are provided by:
* @dataProvider provideMappedSeverities
*
*/
public function testNotifyGetsPassedCorrectlyMappedSeverity($monologLevel, $expectedSeverity)
{
// Update the tested handler to always send messages rather than just errors.
$this->monolog->popHandler($this->testedHandler);
$this->testedHandler = new BugsnagHandler($this->mockBugsnag->reveal(), Logger::DEBUG);
$this->monolog->pushHandler($this->testedHandler);
$errorMessage = "Oh no!";
$this->mockBugsnag->notifyError($expectedSeverity, Argument::any(), Argument::any(), $expectedSeverity)->shouldBeCalledTimes(1);
$this->monolog->log($monologLevel, $errorMessage);
}
/**
* Get tasks that are due to run
*
* @access public
* @return array A list of {@link Task} objects.
*/
public function getDueTasks()
{
$this->logger->log(Logger::DEBUG, 'Checking tasks that are due to run. ' . count($this->tasks) . ' total tasks.');
$t = [];
foreach ($this->tasks as $task) {
$this->logger->log(Logger::DEBUG, 'Checking on "' . $task->getName() . '" (' . $task->getCronString() . ')');
if ($task->isDue()) {
$t[] = $task;
$this->logger->log(Logger::DEBUG, '"' . $task->getName() . '" IS set to run');
} else {
$this->logger->log(Logger::DEBUG, '"' . $task->getName() . '" is not set to run');
}
}
return $t;
}
/**
* 写入日志
* @param $msg
* @param $name
* @param int $level
* @param AbstractHandler $handler
*/
public static function write($msg, $name, $level = Logger::INFO, AbstractHandler $handler = null)
{
$name .= '_' . $level;
$name = $name . '_' . date('Y-m-d-H', Date::now());
if (isset(self::$loggers[$name])) {
$logger = self::$loggers[$name];
if ($handler != null) {
$logger->pushHandler($handler);
}
} else {
$logger = new Logger($name);
if ($handler == null) {
$path = ConfigManager::get('log');
$handler = new StreamHandler($path . DIRECTORY_SEPARATOR . $name . '.log', $level);
$formatter = new LineFormatter(ConfigManager::get('log_formatter'), 'Y-m-d H:i:s');
$handler->setFormatter($formatter);
}
$logger->pushHandler($handler);
self::$loggers[$name] = $logger;
}
if (is_scalar($msg) === false) {
$msg = json_encode($msg);
}
$logger->log($level, $msg);
}
/**
* Extract metadatas from XML
*
* @param \DOMDocument $document wanted document
* @return array
*/
private function extractDatasFromXML(\DOMDocument $document)
{
$datas = array();
$xpath = new \DOMXPath($document);
$xPathQuery = CssSelector::toXPath('description > *');
$structure = $this->config->get('structure');
foreach ($xpath->query($xPathQuery) as $node) {
$nodeName = $node->nodeName;
$value = $node->nodeValue;
$meta = isset($structure[$nodeName]) ? $structure[$nodeName] : null;
$isMulti = !isset($meta['multi']) ? false : !!$meta['multi'];
if (!$meta) {
$this->logger->log(sprintf('undefined meta name %s', $nodeName));
continue;
}
if (!isset($datas[$nodeName])) {
$datas[$nodeName] = array('values' => array(), 'meta_src' => $meta['src'], 'multi' => $isMulti);
}
if ($nodeName == 'Date' || $nodeName == 'DatePrisedeVue') {
$value = str_replace('/', ':', $value);
}
$datas[$nodeName]['values'][] = $value;
}
return $datas;
}
/**
* Performs an authentication attempt
*
* @return \Zend\Authentication\Result
* @throws \Zend\Authentication\Adapter\Exception\ExceptionInterface If authentication cannot be performed
*/
public function authenticate()
{
$result = null;
foreach ($this->adapters as $adapter) {
$result = $adapter->authenticate();
if ($this->logger !== null) {
foreach ($result->getMessages() as $message) {
$this->logger->log($result->getCode() > 0 ? Logger::INFO : Logger::ERROR, $message);
}
}
if ($result->isValid()) {
//Stop processing on first success result
break;
}
}
return $result;
}
/**
* block and log the user request
*/
private function blockRequest()
{
if ($this->logger instanceof Logger) {
$this->logger->log(Logger::INFO, sprintf("blocked a requests flood for page %s%s from ip: %s with cookie %s", $this->getHttpHost(), $this->getRequestUri(), $this->getIpAddress(), $this->getCookie()));
header('HTTP/1.0 403 Forbidden');
}
exit(sprintf('please wait %s seconds and refresh the page', $this->blockingPeriod));
}
/**
* On dispatch event listener - called on any event
*
* @param Event $event
* @param string $eventName
* @return void
*/
private function log($level, $message, $ev, array $context = [])
{
if ($this->logger) {
$message = sprintf("QueueGet [1;36m%s@%s[0m %s", $ev->getRoutingKey(), $ev->getExchangeName(), $message);
$context["command"] = AddonsEvent::QUEUE_GET_COMMAND;
$this->logger->log($level, $message, $context);
}
}
/**
* {@inheritdoc}
*/
public function flushBuffer($force = false)
{
if (!empty($this->request_arguments) || $force) {
foreach ($this->buffer as $log_entry) {
$this->logger->log($log_entry['level'], $log_entry['message'], array_merge($this->env_arguments, $this->request_arguments, $log_entry['context']));
}
$this->buffer = [];
}
}
function primeExceptionHandler(Exception $exc)
{
$logger = new Logger('app_runtime');
$logger->pushHandler(new RotatingFileHandler(Filesystem::getInstance()->getPath('log') . '/app.log'));
$code = $exc->getCode();
if ($code == 0) {
$code = Logger::ALERT;
}
$logger->log($code, $exc->getMessage());
}
/**
* Run task
*
* Note that the optional params are here because the lib expects this
* functionality but if a developer were to extend the lib, these may
* no longer be relevant. For more on this, see the comment that's inside
* {@link Shideon\Tasker\AbstractCommand::getConfigOptions()}
*
* @access public
* @param bool $async Run asynchronously
* @param string $configFile Config file to send to command.
* @param string $logFile Log file to send to command.
* @param string $logLevel Log level to pass to command.
*/
public function run($async, $configFile = null, $logFile = null, $logLevel = null)
{
$this->validate();
$cmd = $this->buildRunCommand($async, $configFile, $logFile, $logLevel);
$this->logger->log(Logger::INFO, "Running task '" . $this->getName() . "' in background: {$cmd}");
// note that we use shell_exec instead of symfony's
// Process because it's causing issues with
// sub process having open file handle.
shell_exec($cmd);
}
/**
* @see \Monolog\Logger::log()
*
* @param string $level [debug,info,notice,warning,error,critical,alert,emergency]
* @param string $message
* @param array $context
* @return bool
*/
public static function log($level, $message, array $context = [])
{
if (self::$logger == null) {
if (self::$strict) {
$e = new Exception("Logger has not been set!");
$e->setData(array("level" => $level, "message" => $message, "context" => $context));
throw $e;
} else {
return false;
}
}
return self::$logger->log($level, $message, $context);
}
public function log($level = Logger::INFO, $message = '[no message]', $context = array(), $description = null, $tags = array(), $serialiseContext = false)
{
$this->initLogger();
// collect pertinent information for log
$this->callingClass = $this->callingMethod = null;
$this->tags = $tags;
$this->description = $description;
$backtrace = debug_backtrace(DEBUG_BACKTRACE_IGNORE_ARGS);
$this->callingClass = isset($backtrace[1]['class']) ? $backtrace[1]['class'] : null;
$this->callingMethod = isset($backtrace[1]['function']) ? $backtrace[1]['function'] : null;
// optionally serialise the context data
if ($serialiseContext && !empty($context)) {
$context = ['context-serialised' => serialize($context)];
}
try {
$this->logger->log($level, $message, is_array($context) ? $context : [$context]);
} catch (Exception $e) {
// something went wrong - investigation will be conducted when it is seen that no new logs are created
}
}
/**
* @param \stdClass $dataRow
* @param string $type for logging
* @param string $outerObjectHash
* @return string
*/
protected function getPrimaryKeyValue(\stdClass $dataRow, $type, $outerObjectHash = null)
{
// Try to find a "real" parent ID
if (!empty($this->primaryKeys[$this->createSafeName($type)])) {
$pk = $this->primaryKeys[$this->createSafeName($type)];
$pKeyCols = explode(',', $pk);
$pKeyCols = array_map('trim', $pKeyCols);
$values = [];
foreach ($pKeyCols as $pKeyCol) {
if (empty($dataRow->{$pKeyCol})) {
$values[] = md5(serialize($dataRow) . $outerObjectHash);
$this->log->log("WARNING", "Primary key for type '{$type}' was set to '{$pk}', but its column '{$pKeyCol}' does not exist! Using hash to link child objects instead.", ['row' => $dataRow]);
} else {
$values[] = $dataRow->{$pKeyCol};
}
}
return $type . "_" . join(";", $values);
} else {
// Of no pkey is specified to get the real ID, use a hash of the row
return $type . "_" . md5(serialize($dataRow) . $outerObjectHash);
}
}
/**
* Analyze row of input data & create $this->struct
*
* @param mixed $row
* @param string $type
* @return void
*/
protected function analyzeRow($row, $type)
{
// Current row's structure
$struct = [];
$rowType = $this->getType($row);
// If the row is scalar, make it a {"data" => $value} object
if (is_scalar($row)) {
$struct[Parser::DATA_COLUMN] = $this->getType($row);
} elseif (is_object($row)) {
// process each property of the object
foreach ($row as $key => $field) {
$fieldType = $this->getType($field);
if ($fieldType == "object") {
// Only assign the type if the object isn't empty
if (Utils::isEmptyObject($field)) {
continue;
}
$this->analyzeRow($field, $type . "." . $key);
} elseif ($fieldType == "array") {
$arrayType = $this->analyze($field, $type . "." . $key);
if (false !== $arrayType) {
$fieldType = 'arrayOf' . $arrayType;
} else {
$fieldType = 'NULL';
}
}
$struct[$key] = $fieldType;
}
} elseif ($this->nestedArrayAsJson && is_array($row)) {
$this->log->log("WARNING", "Unsupported array nesting in '{$type}'! Converting to JSON string.", ['row' => $row]);
$rowType = $struct[Parser::DATA_COLUMN] = 'string';
} elseif (is_null($row)) {
// do nothing
} else {
throw new JsonParserException("Unsupported data row in '{$type}'!", ['row' => $row]);
}
$this->getStruct()->add($type, $struct);
return $rowType;
}
/**
* Sends a message to Monolog.
*
* @param string $message The message to write
* @param int $level One of the levels defined by Monolog (e.g. INFO, DEBUG, ERROR, etc.)
* @param array $context
*/
private function log($message, $level = Logger::DEBUG, $context = array())
{
if ($this->logger instanceof Logger) {
$this->logger->log($level, $message, $context);
}
}
public function log($message, $level = self::DEBUG, array $context = [])
{
$level = $this->translateLevel($level);
return parent::log($level, $message, $context);
}
/**
* Logs with an arbitrary level.
*
* @param mixed $level
* @param string $message
* @param array $context
* @return null
*/
public function log($level, $message, array $context = array())
{
$this->logger->log($level, $message, $context);
}
/**
* Adds a log record at an arbitrary level.
*
* This method allows for compatibility with common interfaces.
*
* @param mixed $level The log level
* @param string $message The log message
* @param array $context The log context
* @return Boolean Whether the record has been processed
* @static
*/
public static function log($level, $message, $context = array())
{
return \Monolog\Logger::log($level, $message, $context);
}
/**
* Convenience method to log a message.
*
* @param string $message
* @param array $context
* @param string $level
*/
private function log($message, $context = array(), $level = 'info')
{
$this->logger->log($level, $message, $context);
}
/**
* @param mixed $level
* @param string $message
* @param array $context
* @return bool
*/
public function log($level, $message, array $context = array())
{
return parent::log($level, $message, $context);
}
/**
* Logs with an arbitrary level.
*
* @param mixed $level
* @param string $message
* @param array $params
* @param array $context
* @return null
*/
public function log($level, $message, array $params = array(), array $context = array())
{
$logMessage = $this->createMessage($message, $params);
$this->logger->log($level, $logMessage, $context);
}
/**
* Logs a message with the given type and category.
*
* @param string $message the message to be logged.
* @param integer $level the level of the message. This must be one of the following:
* `Logger::LEVEL_ERROR`, `Logger::LEVEL_WARNING`, `Logger::LEVEL_INFO`, `Logger::LEVEL_TRACE`,
* `Logger::LEVEL_PROFILE_BEGIN`, `Logger::LEVEL_PROFILE_END`.
* @param string $category the category of the message.
*
* @return boolean Whether the record has been processed.
*/
public function yiiLog($message, $level, $category = 'application')
{
return $this->_monolog->log($level, $message, ['category' => $category]);
}
/**
* Adds a log record at an arbitrary level.
*
* This method allows for compatibility with common interfaces.
*
* @param mixed $level The log level
* @param string $message The log message
* @param array $context The log context
* @return Boolean Whether the record has been processed
*/
public function log($level, $message, array $context = array())
{
if (defined('NFWP_LOG') && NFWP_LOG) {
return $this->logger->log($level, $message, $context);
}
}
/**
* Common function to log, wrapper for comunicate with monolog
*
* @param string $channel The loggin channel
* @param string $message The log message
* @param integer $level The level to log [optional]
* @param array $context The log context
* @return void
* @todo
- Add custom way for log location
*/
public function log($message, $level = Logger::DEBUG, array $context = [])
{
self::$logger->log($level, $message, $context);
}
public function log($level, $log, array $context = array())
{
parent::log($level, $log, $context);
}
<?php
$start = microtime(true);
require_once 'vendor/autoload.php';
use Monolog\Formatter\LogstashFormatter;
use Monolog\Logger;
$log = new Logger('myapp_logger');
$logPath = 'C:\\Programs\\dev\\logstash-2.1.1\\bin\\logstash.log';
$stream = new Monolog\Handler\StreamHandler($logPath);
$log->pushHandler($stream);
$eventSourceName = '127.0.0.1';
$eventTypeName = 'monolog_sourced_log';
$formater = new LogstashFormatter($eventTypeName, $eventSourceName, null, 'ctxt_', LogstashFormatter::V1);
$stream->setFormatter($formater);
$processor = new Monolog\Processor\WebProcessor();
$log->pushProcessor($processor);
usleep(rand(1, 100) * 1000);
$elapsed = (microtime(true) - $start) * 1000;
$log->log(Logger::DEBUG, 'Request logged', ['timing' => $elapsed]);
/**
* Adds a log record.
*
* @param integer $level The logging level
* @param string $message The log message
* @param array $context The log context
* @return bool Whether the record has been processed
*/
public function log($level, $message, array $context = [])
{
return $this->monolog->log($level, $message, $context);
}
/**
* If enabled, and an object contains an array where
* an array is not expected, a "link" ID is saved in place
* of the string and a child CSV is created.
*
* This should **only** be used with $analyzeRows = -1
*
* Only enable this as a last resort if you cannot supply a JSON
* without inconsistent array/object conflicts
* @param bool $enable
* @experimental
*/
public function setAutoUpgradeToArray($enable)
{
$this->log->log('debug', "Using automatic conversion of single values to arrays where required.");
$this->autoUpgradeToArray = (bool) $enable;
}